About 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one
3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one (PubChem CID 146144048) has the molecular formula C14H14N2O3S
and a molecular weight of 290.34 g/mol. Its IUPAC name is 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one |
| PubChem CID | 146144048 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one |
| SMILES | COCc1cc(Cn2c(=O)sc3c(C)cccc32)no1 |
| InChI | InChI=1S/C14H14N2O3S/c1-9-4-3-5-12-13(9)20-14(17)16(12)7-10-6-11(8-18-2)19-15-10/h3-6H,7-8H2,1-2H3 |
| InChIKey | HQKFVGLZTKGZQL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one?
The IUPAC name of 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one (CID 146144048) is 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one.
What is the SMILES notation for 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one?
The canonical SMILES for 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one is COCc1cc(Cn2c(=O)sc3c(C)cccc32)no1.
What is the InChIKey of 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one?
The InChIKey is HQKFVGLZTKGZQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3S/c1-9-4-3-5-12-13(9)20-14(17)16(12)7-10-6-11(8-18-2)19-15-10/h3-6H,7-8H2,1-2H3.
What are the key properties of 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one?
3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one has a molecular weight of 290.34 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-7-methyl-1,3-benzothiazol-2-one is sourced from PubChem (CID 146144048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).