C14H15FN2O3 — CID 146144104
4-[(2-ethyl-4-methyl-1,3-oxazol-5-yl)methoxy]-3-fluorobenzamide (PubChem CID 146144104) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 4-[(2-ethyl-4-methyl-1,3-oxazol-5-yl)methoxy]-3-fluorobenzamide.
| Compound Name | 4-[(2-ethyl-4-methyl-1,3-oxazol-5-yl)methoxy]-3-fluorobenzamide |
|---|---|
| PubChem CID | 146144104 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-[(2-ethyl-4-methyl-1,3-oxazol-5-yl)methoxy]-3-fluorobenzamide |
| SMILES | CCc1nc(C)c(COc2ccc(C(N)=O)cc2F)o1 |
| InChI | InChI=1S/C14H15FN2O3/c1-3-13-17-8(2)12(20-13)7-19-11-5-4-9(14(16)18)6-10(11)15/h4-6H,3,7H2,1-2H3,(H2,16,18) |
| InChIKey | KVOJQWQIDHCDQZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |