About 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide
2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide (PubChem CID 146144229) has the molecular formula C7H8N6OS
and a molecular weight of 224.25 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide |
| PubChem CID | 146144229 |
| Molecular Formula | C7H8N6OS |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide |
| SMILES | Cc1cc(Cn2nnc(C(N)=O)n2)sn1 |
| InChI | InChI=1S/C7H8N6OS/c1-4-2-5(15-11-4)3-13-10-7(6(8)14)9-12-13/h2H,3H2,1H3,(H2,8,14) |
| InChIKey | NLHDWVXSCHDIKF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide?
The IUPAC name of 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide (CID 146144229) is 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide.
What is the SMILES notation for 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide?
The canonical SMILES for 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide is Cc1cc(Cn2nnc(C(N)=O)n2)sn1.
What is the InChIKey of 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide?
The InChIKey is NLHDWVXSCHDIKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6OS/c1-4-2-5(15-11-4)3-13-10-7(6(8)14)9-12-13/h2H,3H2,1H3,(H2,8,14).
What are the key properties of 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide?
2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide has a molecular weight of 224.25 g/mol, XLogP of -0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methyl-1,2-thiazol-5-yl)methyl]tetrazole-5-carboxamide is sourced from PubChem (CID 146144229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).