C18H19ClN4O2 — CID 146146772
[(3aS,6aS)-5-[(E)-3-chloroprop-2-enyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(3-pyridin-2-yl-1,2-oxazol-5-yl)methanone (PubChem CID 146146772) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is [(3aS,6aS)-5-[(E)-3-chloroprop-2-enyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(3-pyridin-2-yl-1,2-oxazol-5-yl)methanone.
| Compound Name | [(3aS,6aS)-5-[(E)-3-chloroprop-2-enyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(3-pyridin-2-yl-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 146146772 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [(3aS,6aS)-5-[(E)-3-chloroprop-2-enyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(3-pyridin-2-yl-1,2-oxazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccn2)no1)N1CC[C@H]2CN(C/C=C/Cl)C[C@H]21 |
| InChI | InChI=1S/C18H19ClN4O2/c19-6-3-8-22-11-13-5-9-23(16(13)12-22)18(24)17-10-15(21-25-17)14-4-1-2-7-20-14/h1-4,6-7,10,13,16H,5,8-9,11-12H2/b6-3+/t13-,16+/m0/s1 |
| InChIKey | CSLXADLVJSHBQU-RYIFVZQSSA-N |
| XLogP | 2.64 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |