About (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate
(3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate (PubChem CID 146147494) has the molecular formula C16H15BrCl2O3S
and a molecular weight of 438.17 g/mol. Its IUPAC name is (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate.
Molecular Properties
| Compound Name | (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate |
| PubChem CID | 146147494 |
| Molecular Formula | C16H15BrCl2O3S |
| Molecular Weight | 438.17 g/mol |
| Exact Mass | 435.93 |
| IUPAC Name | (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)c2cc(Cl)c(Cl)cc2Br)ccc1C(C)C |
| InChI | InChI=1S/C16H15BrCl2O3S/c1-9(2)12-5-4-11(6-10(12)3)22-23(20,21)16-8-15(19)14(18)7-13(16)17/h4-9H,1-3H3 |
| InChIKey | FAFDAEOXLDNJIZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.17 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate?
The IUPAC name of (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate (CID 146147494) is (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate.
What is the SMILES notation for (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate?
The canonical SMILES for (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate is Cc1cc(OS(=O)(=O)c2cc(Cl)c(Cl)cc2Br)ccc1C(C)C.
What is the InChIKey of (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate?
The InChIKey is FAFDAEOXLDNJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrCl2O3S/c1-9(2)12-5-4-11(6-10(12)3)22-23(20,21)16-8-15(19)14(18)7-13(16)17/h4-9H,1-3H3.
What are the key properties of (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate?
(3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate has a molecular weight of 438.17 g/mol, XLogP of 5.96, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-4-propan-2-ylphenyl) 2-bromo-4,5-dichlorobenzenesulfonate is sourced from PubChem (CID 146147494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).