About N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide
N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide (PubChem CID 146147662) has the molecular formula C18H16BrF3N2O3S
and a molecular weight of 477.30 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide.
Molecular Properties
| Compound Name | N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide |
| PubChem CID | 146147662 |
| Molecular Formula | C18H16BrF3N2O3S |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide |
| SMILES | CN1C(=O)Cc2cc(S(=O)(=O)NC(CC(F)(F)F)c3ccc(Br)cc3)ccc21 |
| InChI | InChI=1S/C18H16BrF3N2O3S/c1-24-16-7-6-14(8-12(16)9-17(24)25)28(26,27)23-15(10-18(20,21)22)11-2-4-13(19)5-3-11/h2-8,15,23H,9-10H2,1H3 |
| InChIKey | JXSNWMFPUMFSJG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide?
The IUPAC name of N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide (CID 146147662) is N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide.
What is the SMILES notation for N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide?
The canonical SMILES for N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide is CN1C(=O)Cc2cc(S(=O)(=O)NC(CC(F)(F)F)c3ccc(Br)cc3)ccc21.
What is the InChIKey of N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide?
The InChIKey is JXSNWMFPUMFSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrF3N2O3S/c1-24-16-7-6-14(8-12(16)9-17(24)25)28(26,27)23-15(10-18(20,21)22)11-2-4-13(19)5-3-11/h2-8,15,23H,9-10H2,1H3.
What are the key properties of N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide?
N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide has a molecular weight of 477.30 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide is sourced from PubChem (CID 146147662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).