About (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride
(2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (PubChem CID 146148265) has the molecular formula C8H18Cl2N2
and a molecular weight of 213.15 g/mol. Its IUPAC name is (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| PubChem CID | 146148265 |
| Molecular Formula | C8H18Cl2N2 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| SMILES | C[C@@H]1[C@@H](N)C2CCN1CC2.Cl.Cl |
| InChI | InChI=1S/C8H16N2.2ClH/c1-6-8(9)7-2-4-10(6)5-3-7;;/h6-8H,2-5,9H2,1H3;2*1H/t6-,8-;;/m1../s1 |
| InChIKey | IYWLMYXIUVLLGB-QGTMZHJHSA-N |
| XLogP | 1.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride?
The IUPAC name of (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (CID 146148265) is (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride.
What is the SMILES notation for (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride?
The canonical SMILES for (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride is C[C@@H]1[C@@H](N)C2CCN1CC2.Cl.Cl.
What is the InChIKey of (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride?
The InChIKey is IYWLMYXIUVLLGB-QGTMZHJHSA-N. The full InChI is InChI=1S/C8H16N2.2ClH/c1-6-8(9)7-2-4-10(6)5-3-7;;/h6-8H,2-5,9H2,1H3;2*1H/t6-,8-;;/m1../s1.
What are the key properties of (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride?
(2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride has a molecular weight of 213.15 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-methyl-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride is sourced from PubChem (CID 146148265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).