About 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine
4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine (PubChem CID 146149254) has the molecular formula C13H23F2NO4S
and a molecular weight of 327.39 g/mol. Its IUPAC name is 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine.
Molecular Properties
| Compound Name | 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine |
| PubChem CID | 146149254 |
| Molecular Formula | C13H23F2NO4S |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine |
| SMILES | CC1COCCN1S(=O)(=O)CC1(C(C)(F)F)CCOCC1 |
| InChI | InChI=1S/C13H23F2NO4S/c1-11-9-20-8-5-16(11)21(17,18)10-13(12(2,14)15)3-6-19-7-4-13/h11H,3-10H2,1-2H3 |
| InChIKey | ATIAPYOOFUPGEU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine?
The IUPAC name of 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine (CID 146149254) is 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine.
What is the SMILES notation for 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine?
The canonical SMILES for 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine is CC1COCCN1S(=O)(=O)CC1(C(C)(F)F)CCOCC1.
What is the InChIKey of 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine?
The InChIKey is ATIAPYOOFUPGEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F2NO4S/c1-11-9-20-8-5-16(11)21(17,18)10-13(12(2,14)15)3-6-19-7-4-13/h11H,3-10H2,1-2H3.
What are the key properties of 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine?
4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine has a molecular weight of 327.39 g/mol, XLogP of 1.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(1,1-difluoroethyl)oxan-4-yl]methylsulfonyl]-3-methylmorpholine is sourced from PubChem (CID 146149254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).