C18H23NO3S — CID 146149447
1-(4-methyloxan-4-yl)-N-(naphthalen-1-ylmethyl)methanesulfonamide (PubChem CID 146149447) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 1-(4-methyloxan-4-yl)-N-(naphthalen-1-ylmethyl)methanesulfonamide.
| Compound Name | 1-(4-methyloxan-4-yl)-N-(naphthalen-1-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 146149447 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-(4-methyloxan-4-yl)-N-(naphthalen-1-ylmethyl)methanesulfonamide |
| SMILES | CC1(CS(=O)(=O)NCc2cccc3ccccc23)CCOCC1 |
| InChI | InChI=1S/C18H23NO3S/c1-18(9-11-22-12-10-18)14-23(20,21)19-13-16-7-4-6-15-5-2-3-8-17(15)16/h2-8,19H,9-14H2,1H3 |
| InChIKey | UWXBYCYZOIMXDR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |