C10H13F3N4OS2 — CID 146149705
1-(2-cyclopropylethyl)-1-methyl-3-[5-(trifluoromethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 146149705) has the molecular formula C10H13F3N4OS2 and a molecular weight of 326.37 g/mol. Its IUPAC name is 1-(2-cyclopropylethyl)-1-methyl-3-[5-(trifluoromethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(2-cyclopropylethyl)-1-methyl-3-[5-(trifluoromethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 146149705 |
| Molecular Formula | C10H13F3N4OS2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-(2-cyclopropylethyl)-1-methyl-3-[5-(trifluoromethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | CN(CCC1CC1)C(=O)Nc1nnc(SC(F)(F)F)s1 |
| InChI | InChI=1S/C10H13F3N4OS2/c1-17(5-4-6-2-3-6)8(18)14-7-15-16-9(19-7)20-10(11,12)13/h6H,2-5H2,1H3,(H,14,15,18) |
| InChIKey | ZGWCILWTLPUODO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|