C15H16F2N2O3 — CID 146150188
N-(2,3-difluorophenyl)-N'-(1,3-dimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)oxamide (PubChem CID 146150188) has the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-N'-(1,3-dimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)oxamide.
| Compound Name | N-(2,3-difluorophenyl)-N'-(1,3-dimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)oxamide |
|---|---|
| PubChem CID | 146150188 |
| Molecular Formula | C15H16F2N2O3 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-(2,3-difluorophenyl)-N'-(1,3-dimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)oxamide |
| SMILES | CC1OC2(C)CC1(NC(=O)C(=O)Nc1cccc(F)c1F)C2 |
| InChI | InChI=1S/C15H16F2N2O3/c1-8-15(6-14(2,7-15)22-8)19-13(21)12(20)18-10-5-3-4-9(16)11(10)17/h3-5,8H,6-7H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | ZXZHRLLLGTZWBK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|