C11H18N2O3 — CID 146150249
(3aS,5S,6aS)-4-acetyl-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 146150249) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is (3aS,5S,6aS)-4-acetyl-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aS,5S,6aS)-4-acetyl-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146150249 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (3aS,5S,6aS)-4-acetyl-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | CC(=O)N1[C@H](C(=O)N(C)C)C[C@@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C11H18N2O3/c1-7(14)13-8-4-5-16-10(8)6-9(13)11(15)12(2)3/h8-10H,4-6H2,1-3H3/t8-,9-,10-/m0/s1 |
| InChIKey | ZTNQBXUOBQORSQ-GUBZILKMSA-N |
| XLogP | -0.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |