C13H19NO4 — CID 146150349
2,2-dimethyl-5-[(2-methylfuran-3-carbonyl)amino]pentanoic acid (PubChem CID 146150349) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(2-methylfuran-3-carbonyl)amino]pentanoic acid.
| Compound Name | 2,2-dimethyl-5-[(2-methylfuran-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 146150349 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2,2-dimethyl-5-[(2-methylfuran-3-carbonyl)amino]pentanoic acid |
| SMILES | Cc1occc1C(=O)NCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H19NO4/c1-9-10(5-8-18-9)11(15)14-7-4-6-13(2,3)12(16)17/h5,8H,4,6-7H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | KZQGKLJELLLHSN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|