About trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane
trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane (PubChem CID 14615104) has the molecular formula C10H18N2O3Si
and a molecular weight of 242.35 g/mol. Its IUPAC name is trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane.
Molecular Properties
| Compound Name | trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane |
| PubChem CID | 14615104 |
| Molecular Formula | C10H18N2O3Si |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane |
| SMILES | COc1nc(OC)c([Si](C)(C)C)c(OC)n1 |
| InChI | InChI=1S/C10H18N2O3Si/c1-13-8-7(16(4,5)6)9(14-2)12-10(11-8)15-3/h1-6H3 |
| InChIKey | ZYLNHVWUOFPWSU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane?
The IUPAC name of trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane (CID 14615104) is trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane.
What is the SMILES notation for trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane?
The canonical SMILES for trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane is COc1nc(OC)c([Si](C)(C)C)c(OC)n1.
What is the InChIKey of trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane?
The InChIKey is ZYLNHVWUOFPWSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3Si/c1-13-8-7(16(4,5)6)9(14-2)12-10(11-8)15-3/h1-6H3.
What are the key properties of trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane?
trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane has a molecular weight of 242.35 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(2,4,6-trimethoxypyrimidin-5-yl)silane is sourced from PubChem (CID 14615104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).