C20H30N2O2 — CID 1461516
4-ethoxy-N-[(1S,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]benzamide (PubChem CID 1461516) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4-ethoxy-N-[(1S,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]benzamide.
| Compound Name | 4-ethoxy-N-[(1S,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]benzamide |
|---|---|
| PubChem CID | 1461516 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 4-ethoxy-N-[(1S,5R)-9-propyl-9-azabicyclo[3.3.1]nonan-3-yl]benzamide |
| SMILES | CCCN1[C@@H]2CCC[C@H]1CC(NC(=O)c1ccc(OCC)cc1)C2 |
| InChI | InChI=1S/C20H30N2O2/c1-3-12-22-17-6-5-7-18(22)14-16(13-17)21-20(23)15-8-10-19(11-9-15)24-4-2/h8-11,16-18H,3-7,12-14H2,1-2H3,(H,21,23)/t16?,17-,18+ |
| InChIKey | PBCQKZIFAISVHM-AYHJJNSGSA-N |
| XLogP | 3.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |