About 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione
8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione (PubChem CID 14615266) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione.
Molecular Properties
| Compound Name | 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione |
| PubChem CID | 14615266 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione |
| SMILES | O=C1NC(Cc2ccccc2)=C(O)C(=O)C12CCCC2 |
| InChI | InChI=1S/C16H17NO3/c18-13-12(10-11-6-2-1-3-7-11)17-15(20)16(14(13)19)8-4-5-9-16/h1-3,6-7,18H,4-5,8-10H2,(H,17,20) |
| InChIKey | UUPJALNGUDADNZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione?
The IUPAC name of 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione (CID 14615266) is 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione.
What is the SMILES notation for 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione?
The canonical SMILES for 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione is O=C1NC(Cc2ccccc2)=C(O)C(=O)C12CCCC2.
What is the InChIKey of 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione?
The InChIKey is UUPJALNGUDADNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c18-13-12(10-11-6-2-1-3-7-11)17-15(20)16(14(13)19)8-4-5-9-16/h1-3,6-7,18H,4-5,8-10H2,(H,17,20).
What are the key properties of 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione?
8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione has a molecular weight of 271.32 g/mol, XLogP of 2.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-9-hydroxy-7-azaspiro[4.5]dec-8-ene-6,10-dione is sourced from PubChem (CID 14615266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).