About N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide
N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide (PubChem CID 146152849) has the molecular formula C8H11F2N3O2
and a molecular weight of 219.19 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide |
| PubChem CID | 146152849 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide |
| SMILES | COc1nn(CC(F)F)cc1NC(C)=O |
| InChI | InChI=1S/C8H11F2N3O2/c1-5(14)11-6-3-13(4-7(9)10)12-8(6)15-2/h3,7H,4H2,1-2H3,(H,11,14) |
| InChIKey | IEOPUFZOOSXGDM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide?
The IUPAC name of N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide (CID 146152849) is N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide.
What is the SMILES notation for N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide?
The canonical SMILES for N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide is COc1nn(CC(F)F)cc1NC(C)=O.
What is the InChIKey of N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide?
The InChIKey is IEOPUFZOOSXGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O2/c1-5(14)11-6-3-13(4-7(9)10)12-8(6)15-2/h3,7H,4H2,1-2H3,(H,11,14).
What are the key properties of N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide?
N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide has a molecular weight of 219.19 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,2-difluoroethyl)-3-methoxypyrazol-4-yl]acetamide is sourced from PubChem (CID 146152849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).