C21H19N5O2S — CID 146153070
2-benzyl-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 146153070) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-benzyl-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | 2-benzyl-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 146153070 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-benzyl-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)c2cnc3sc(Cc4ccccc4)cn3c2=O)N=N1 |
| InChI | InChI=1S/C21H19N5O2S/c1-2-3-9-21(24-25-21)10-11-22-18(27)17-13-23-20-26(19(17)28)14-16(29-20)12-15-7-5-4-6-8-15/h1,4-8,13-14H,3,9-12H2,(H,22,27) |
| InChIKey | HTSBUIHAOFSTHM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|