About 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride
2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride (PubChem CID 146154023) has the molecular formula C7H9ClN4
and a molecular weight of 184.63 g/mol. Its IUPAC name is 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride |
| PubChem CID | 146154023 |
| Molecular Formula | C7H9ClN4 |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride |
| SMILES | Cc1nn2cccnc2c1N.Cl |
| InChI | InChI=1S/C7H8N4.ClH/c1-5-6(8)7-9-3-2-4-11(7)10-5;/h2-4H,8H2,1H3;1H |
| InChIKey | PDMWUZMPGUAIIQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The IUPAC name of 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride (CID 146154023) is 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride.
What is the SMILES notation for 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The canonical SMILES for 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride is Cc1nn2cccnc2c1N.Cl.
What is the InChIKey of 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
The InChIKey is PDMWUZMPGUAIIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.ClH/c1-5-6(8)7-9-3-2-4-11(7)10-5;/h2-4H,8H2,1H3;1H.
What are the key properties of 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride?
2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride has a molecular weight of 184.63 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride is sourced from PubChem (CID 146154023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).