C13H14N2O5S2 — CID 146154055
2-(2,3-dimethoxyphenyl)-N-methylsulfonyl-1,3-thiazole-4-carboxamide (PubChem CID 146154055) has the molecular formula C13H14N2O5S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-N-methylsulfonyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2,3-dimethoxyphenyl)-N-methylsulfonyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 146154055 |
| Molecular Formula | C13H14N2O5S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-N-methylsulfonyl-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc(-c2nc(C(=O)NS(C)(=O)=O)cs2)c1OC |
| InChI | InChI=1S/C13H14N2O5S2/c1-19-10-6-4-5-8(11(10)20-2)13-14-9(7-21-13)12(16)15-22(3,17)18/h4-7H,1-3H3,(H,15,16) |
| InChIKey | MAKAJTVIMVMHPU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |