C25H21ClN2O3 — CID 146154131
3-[1-[2-(2-chlorophenoxy)ethyl]indole-3-carbonyl]-N-methylbenzamide (PubChem CID 146154131) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is 3-[1-[2-(2-chlorophenoxy)ethyl]indole-3-carbonyl]-N-methylbenzamide.
| Compound Name | 3-[1-[2-(2-chlorophenoxy)ethyl]indole-3-carbonyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 146154131 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 3-[1-[2-(2-chlorophenoxy)ethyl]indole-3-carbonyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(C(=O)c2cn(CCOc3ccccc3Cl)c3ccccc23)c1 |
| InChI | InChI=1S/C25H21ClN2O3/c1-27-25(30)18-8-6-7-17(15-18)24(29)20-16-28(22-11-4-2-9-19(20)22)13-14-31-23-12-5-3-10-21(23)26/h2-12,15-16H,13-14H2,1H3,(H,27,30) |
| InChIKey | JSYZBILRRILFGN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |