C11H13F2NO4S — CID 146154209
3-[4-(difluoromethoxy)phenyl]-N-methylsulfonylpropanamide (PubChem CID 146154209) has the molecular formula C11H13F2NO4S and a molecular weight of 293.29 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-methylsulfonylpropanamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 146154209 |
| Molecular Formula | C11H13F2NO4S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-methylsulfonylpropanamide |
| SMILES | CS(=O)(=O)NC(=O)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C11H13F2NO4S/c1-19(16,17)14-10(15)7-4-8-2-5-9(6-3-8)18-11(12)13/h2-3,5-6,11H,4,7H2,1H3,(H,14,15) |
| InChIKey | PXLRLCOHRXCECJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |