C19H19N3O4S — CID 146154275
3-(3-methoxyphenyl)-1-(4-methylphenyl)-N-methylsulfonylpyrazole-4-carboxamide (PubChem CID 146154275) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-(4-methylphenyl)-N-methylsulfonylpyrazole-4-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-1-(4-methylphenyl)-N-methylsulfonylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146154275 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-(4-methylphenyl)-N-methylsulfonylpyrazole-4-carboxamide |
| SMILES | COc1cccc(-c2nn(-c3ccc(C)cc3)cc2C(=O)NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H19N3O4S/c1-13-7-9-15(10-8-13)22-12-17(19(23)21-27(3,24)25)18(20-22)14-5-4-6-16(11-14)26-2/h4-12H,1-3H3,(H,21,23) |
| InChIKey | VEFPMNLTBGJMOW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |