C13H12N4O4S — CID 146154460
6-methyl-N-methylsulfonyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 146154460) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is 6-methyl-N-methylsulfonyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | 6-methyl-N-methylsulfonyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 146154460 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 6-methyl-N-methylsulfonyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | Cn1c(C(=O)NS(C)(=O)=O)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C13H12N4O4S/c1-16-9(12(18)15-22(2,20)21)7-8-11(16)14-10-5-3-4-6-17(10)13(8)19/h3-7H,1-2H3,(H,15,18) |
| InChIKey | ZGTQGAHMPCQPDT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |