C14H16N4O4S — CID 146154481
3-(4-methyl-6-oxo-2-pyridin-4-yl-1H-pyrimidin-5-yl)-N-methylsulfonylpropanamide (PubChem CID 146154481) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 3-(4-methyl-6-oxo-2-pyridin-4-yl-1H-pyrimidin-5-yl)-N-methylsulfonylpropanamide.
| Compound Name | 3-(4-methyl-6-oxo-2-pyridin-4-yl-1H-pyrimidin-5-yl)-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 146154481 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-(4-methyl-6-oxo-2-pyridin-4-yl-1H-pyrimidin-5-yl)-N-methylsulfonylpropanamide |
| SMILES | Cc1nc(-c2ccncc2)[nH]c(=O)c1CCC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C14H16N4O4S/c1-9-11(3-4-12(19)18-23(2,21)22)14(20)17-13(16-9)10-5-7-15-8-6-10/h5-8H,3-4H2,1-2H3,(H,18,19)(H,16,17,20) |
| InChIKey | HVIOWRZNHGRIBY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |