About 2-ethylpropane-1,1,3,3-tetracarbonitrile
2-ethylpropane-1,1,3,3-tetracarbonitrile (PubChem CID 14615450) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-ethylpropane-1,1,3,3-tetracarbonitrile.
Molecular Properties
| Compound Name | 2-ethylpropane-1,1,3,3-tetracarbonitrile |
| PubChem CID | 14615450 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-ethylpropane-1,1,3,3-tetracarbonitrile |
| SMILES | CCC(C(C#N)C#N)C(C#N)C#N |
| InChI | InChI=1S/C9H8N4/c1-2-9(7(3-10)4-11)8(5-12)6-13/h7-9H,2H2,1H3 |
| InChIKey | DTYVAWGUBLOTLE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylpropane-1,1,3,3-tetracarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpropane-1,1,3,3-tetracarbonitrile?
The IUPAC name of 2-ethylpropane-1,1,3,3-tetracarbonitrile (CID 14615450) is 2-ethylpropane-1,1,3,3-tetracarbonitrile.
What is the SMILES notation for 2-ethylpropane-1,1,3,3-tetracarbonitrile?
The canonical SMILES for 2-ethylpropane-1,1,3,3-tetracarbonitrile is CCC(C(C#N)C#N)C(C#N)C#N.
What is the InChIKey of 2-ethylpropane-1,1,3,3-tetracarbonitrile?
The InChIKey is DTYVAWGUBLOTLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4/c1-2-9(7(3-10)4-11)8(5-12)6-13/h7-9H,2H2,1H3.
What are the key properties of 2-ethylpropane-1,1,3,3-tetracarbonitrile?
2-ethylpropane-1,1,3,3-tetracarbonitrile has a molecular weight of 172.19 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpropane-1,1,3,3-tetracarbonitrile is sourced from PubChem (CID 14615450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).