About 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride
2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride (PubChem CID 146154966) has the molecular formula C7H13Cl2N3S
and a molecular weight of 242.17 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride |
| PubChem CID | 146154966 |
| Molecular Formula | C7H13Cl2N3S |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride |
| SMILES | Cl.Cl.c1nnc(C2CCNCC2)s1 |
| InChI | InChI=1S/C7H11N3S.2ClH/c1-3-8-4-2-6(1)7-10-9-5-11-7;;/h5-6,8H,1-4H2;2*1H |
| InChIKey | DUOCJUCLHLHCJV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride?
The IUPAC name of 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride (CID 146154966) is 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride.
What is the SMILES notation for 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride?
The canonical SMILES for 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride is Cl.Cl.c1nnc(C2CCNCC2)s1.
What is the InChIKey of 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride?
The InChIKey is DUOCJUCLHLHCJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S.2ClH/c1-3-8-4-2-6(1)7-10-9-5-11-7;;/h5-6,8H,1-4H2;2*1H.
What are the key properties of 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride?
2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride has a molecular weight of 242.17 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-1,3,4-thiadiazole;dihydrochloride is sourced from PubChem (CID 146154966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).