About 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride
4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride (PubChem CID 146155049) has the molecular formula C6H11BrClN
and a molecular weight of 212.52 g/mol. Its IUPAC name is 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride |
| PubChem CID | 146155049 |
| Molecular Formula | C6H11BrClN |
| Molecular Weight | 212.52 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride |
| SMILES | CC1=C(Br)CCNC1.Cl |
| InChI | InChI=1S/C6H10BrN.ClH/c1-5-4-8-3-2-6(5)7;/h8H,2-4H2,1H3;1H |
| InChIKey | DBTZTOZKWPENOM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride?
The IUPAC name of 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride (CID 146155049) is 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride.
What is the SMILES notation for 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride?
The canonical SMILES for 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride is CC1=C(Br)CCNC1.Cl.
What is the InChIKey of 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride?
The InChIKey is DBTZTOZKWPENOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BrN.ClH/c1-5-4-8-3-2-6(5)7;/h8H,2-4H2,1H3;1H.
What are the key properties of 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride?
4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride has a molecular weight of 212.52 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-methyl-1,2,3,6-tetrahydropyridine;hydrochloride is sourced from PubChem (CID 146155049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).