About (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid
(Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146155446) has the molecular formula C6H8F3NO4
and a molecular weight of 215.13 g/mol. Its IUPAC name is (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid |
| PubChem CID | 146155446 |
| Molecular Formula | C6H8F3NO4 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC/C=C\C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C4H7NO2.C2HF3O2/c5-3-1-2-4(6)7;3-2(4,5)1(6)7/h1-2H,3,5H2,(H,6,7);(H,6,7)/b2-1-; |
| InChIKey | BGUISKLZGASSRF-ODZAUARKSA-N |
| XLogP | 0.22 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid (CID 146155446) is (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid is NC/C=C\C(=O)O.O=C(O)C(F)(F)F.
What is the InChIKey of (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid?
The InChIKey is BGUISKLZGASSRF-ODZAUARKSA-N. The full InChI is InChI=1S/C4H7NO2.C2HF3O2/c5-3-1-2-4(6)7;3-2(4,5)1(6)7/h1-2H,3,5H2,(H,6,7);(H,6,7)/b2-1-;.
What are the key properties of (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid?
(Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid has a molecular weight of 215.13 g/mol, XLogP of 0.22, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-aminobut-2-enoic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 146155446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).