About 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane
7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 146155530) has the molecular formula C8H12F3NO2
and a molecular weight of 211.18 g/mol. Its IUPAC name is 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| PubChem CID | 146155530 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | FC(F)(F)C1CC2(CCN1)OCCO2 |
| InChI | InChI=1S/C8H12F3NO2/c9-8(10,11)6-5-7(1-2-12-6)13-3-4-14-7/h6,12H,1-5H2 |
| InChIKey | MEKCBDLUTVMADU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane?
The IUPAC name of 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane (CID 146155530) is 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane.
What is the SMILES notation for 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane?
The canonical SMILES for 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane is FC(F)(F)C1CC2(CCN1)OCCO2.
What is the InChIKey of 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane?
The InChIKey is MEKCBDLUTVMADU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO2/c9-8(10,11)6-5-7(1-2-12-6)13-3-4-14-7/h6,12H,1-5H2.
What are the key properties of 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane?
7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane has a molecular weight of 211.18 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-1,4-dioxa-8-azaspiro[4.5]decane is sourced from PubChem (CID 146155530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).