About 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride
2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride (PubChem CID 146155558) has the molecular formula C9H14ClF2N
and a molecular weight of 209.67 g/mol. Its IUPAC name is 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride.
Molecular Properties
| Compound Name | 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride |
| PubChem CID | 146155558 |
| Molecular Formula | C9H14ClF2N |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride |
| SMILES | Cl.FC1(F)CC2(C1)CC1(CNC1)C2 |
| InChI | InChI=1S/C9H13F2N.ClH/c10-9(11)3-7(4-9)1-8(2-7)5-12-6-8;/h12H,1-6H2;1H |
| InChIKey | OGJBAEGYUJZCCH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride?
The IUPAC name of 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride (CID 146155558) is 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride.
What is the SMILES notation for 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride?
The canonical SMILES for 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride is Cl.FC1(F)CC2(C1)CC1(CNC1)C2.
What is the InChIKey of 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride?
The InChIKey is OGJBAEGYUJZCCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N.ClH/c10-9(11)3-7(4-9)1-8(2-7)5-12-6-8;/h12H,1-6H2;1H.
What are the key properties of 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride?
2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride has a molecular weight of 209.67 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-8-azadispiro[3.1.36.14]decane;hydrochloride is sourced from PubChem (CID 146155558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).