About 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride
5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride (PubChem CID 146155656) has the molecular formula C13H11ClF3NO
and a molecular weight of 289.68 g/mol. Its IUPAC name is 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride |
| PubChem CID | 146155656 |
| Molecular Formula | C13H11ClF3NO |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride |
| SMILES | COc1ccc(-c2cc(F)c(F)c(F)c2)c(N)c1.Cl |
| InChI | InChI=1S/C13H10F3NO.ClH/c1-18-8-2-3-9(12(17)6-8)7-4-10(14)13(16)11(15)5-7;/h2-6H,17H2,1H3;1H |
| InChIKey | YSFJRKVVLIWTAX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride?
The IUPAC name of 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride (CID 146155656) is 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride.
What is the SMILES notation for 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride?
The canonical SMILES for 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride is COc1ccc(-c2cc(F)c(F)c(F)c2)c(N)c1.Cl.
What is the InChIKey of 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride?
The InChIKey is YSFJRKVVLIWTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO.ClH/c1-18-8-2-3-9(12(17)6-8)7-4-10(14)13(16)11(15)5-7;/h2-6H,17H2,1H3;1H.
What are the key properties of 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride?
5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride has a molecular weight of 289.68 g/mol, XLogP of 3.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-(3,4,5-trifluorophenyl)aniline;hydrochloride is sourced from PubChem (CID 146155656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).