C26H46O3Si — CID 146156455
20-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14-tetraenoic acid (PubChem CID 146156455) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is 20-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14-tetraenoic acid.
| Compound Name | 20-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 146156455 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | 20-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14-tetraenoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCC=CCC=CCC=CCC=CCCCC(=O)O |
| InChI | InChI=1S/C26H46O3Si/c1-26(2,3)30(4,5)29-24-22-20-18-16-14-12-10-8-6-7-9-11-13-15-17-19-21-23-25(27)28/h6,8-9,11-12,14-15,17H,7,10,13,16,18-24H2,1-5H3,(H,27,28) |
| InChIKey | KGOSXZYSKSBEHU-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|