C56H64N4 — CID 146157249
5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-1,4,5,10,11,14,15,20,21,22,23,24-dodecahydroporphyrin (PubChem CID 146157249) has the molecular formula C56H64N4 and a molecular weight of 793.16 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-1,4,5,10,11,14,15,20,21,22,23,24-dodecahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-1,4,5,10,11,14,15,20,21,22,23,24-dodecahydroporphyrin |
|---|---|
| PubChem CID | 146157249 |
| Molecular Formula | C56H64N4 |
| Molecular Weight | 793.16 g/mol |
| Exact Mass | 792.51 |
| IUPAC Name | 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-1,4,5,10,11,14,15,20,21,22,23,24-dodecahydroporphyrin |
| SMILES | Cc1cc(C)c(C2c3ccc([nH]3)C(c3c(C)cc(C)cc3C)C3C=CC(N3)C(c3c(C)cc(C)cc3C)c3ccc([nH]3)C(c3c(C)cc(C)cc3C)C3C=CC2N3)c(C)c1 |
| InChI | InChI=1S/C56H64N4/c1-29-21-33(5)49(34(6)22-29)53-41-13-15-43(57-41)54(50-35(7)23-30(2)24-36(50)8)45-17-19-47(59-45)56(52-39(11)27-32(4)28-40(52)12)48-20-18-46(60-48)55(44-16-14-42(53)58-44)51-37(9)25-31(3)26-38(51)10/h13-28,41,43,46,48,53-60H,1-12H3 |
| InChIKey | DLVKXLISDGKTSF-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.16 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|