C8H14N4 — CID 146157907
5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethylhydrazine (PubChem CID 146157907) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethylhydrazine.
| Compound Name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethylhydrazine |
|---|---|
| PubChem CID | 146157907 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethylhydrazine |
| SMILES | NNCc1cn2c(n1)CCCC2 |
| InChI | InChI=1S/C8H14N4/c9-10-5-7-6-12-4-2-1-3-8(12)11-7/h6,10H,1-5,9H2 |
| InChIKey | VYSFMYLDVCAYNX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|