C16H28Cl3NO3Si — CID 146158008
tert-butyl 4-prop-2-enyl-3-(trichloromethyl)-3-trimethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 146158008) has the molecular formula C16H28Cl3NO3Si and a molecular weight of 416.85 g/mol. Its IUPAC name is tert-butyl 4-prop-2-enyl-3-(trichloromethyl)-3-trimethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-prop-2-enyl-3-(trichloromethyl)-3-trimethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146158008 |
| Molecular Formula | C16H28Cl3NO3Si |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | tert-butyl 4-prop-2-enyl-3-(trichloromethyl)-3-trimethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | C=CCC1CN(C(=O)OC(C)(C)C)CC1(O[Si](C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H28Cl3NO3Si/c1-8-9-12-10-20(13(21)22-14(2,3)4)11-15(12,16(17,18)19)23-24(5,6)7/h8,12H,1,9-11H2,2-7H3 |
| InChIKey | IDCJRKOOSVNTKW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|