About Walphos SL-W005-1
Walphos SL-W005-1 (PubChem CID 146159008) has the molecular formula C52H44F12FeO2P2
and a molecular weight of 1046.69 g/mol.
Molecular Properties
| Compound Name | Walphos SL-W005-1 |
| PubChem CID | 146159008 |
| Molecular Formula | C52H44F12FeO2P2 |
| Molecular Weight | 1046.69 g/mol |
| Exact Mass | 1046.20 |
| IUPAC Name | — |
| SMILES | COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)c2ccccc2[C]2[CH][CH][CH][C]2C(C)P(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1C.[CH]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/C47H39F12O2P2.C5H5.Fe/c1-25-15-34(16-26(2)42(25)60-6)63(35-17-27(3)43(61-7)28(4)18-35)41-14-9-8-11-40(41)39-13-10-12-38(39)29(5)62(36-21-30(44(48,49)50)19-31(22-36)45(51,52)53)37-23-32(46(54,55)56)20-33(24-37)47(57,58)59;1-2-4-5-3-1;/h8-24,29H,1-7H3;1-5H; |
| InChIKey | LYSMTOMQQHQCKG-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1046.69 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Walphos SL-W005-1 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Walphos SL-W005-1?
The IUPAC name of Walphos SL-W005-1 (CID 146159008) is not available.
What is the SMILES notation for Walphos SL-W005-1?
The canonical SMILES for Walphos SL-W005-1 is COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)c2ccccc2[C]2[CH][CH][CH][C]2C(C)P(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1C.[CH]1[CH][CH][CH][CH]1.[Fe].
What is the InChIKey of Walphos SL-W005-1?
The InChIKey is LYSMTOMQQHQCKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H39F12O2P2.C5H5.Fe/c1-25-15-34(16-26(2)42(25)60-6)63(35-17-27(3)43(61-7)28(4)18-35)41-14-9-8-11-40(41)39-13-10-12-38(39)29(5)62(36-21-30(44(48,49)50)19-31(22-36)45(51,52)53)37-23-32(46(54,55)56)20-33(24-37)47(57,58)59;1-2-4-5-3-1;/h8-24,29H,1-7H3;1-5H;.
What are the key properties of Walphos SL-W005-1?
Walphos SL-W005-1 has a molecular weight of 1046.69 g/mol, XLogP of 13.43, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Walphos SL-W005-1 is sourced from PubChem (CID 146159008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).