C15H25NO4 — CID 146159167
5,6,7,8-tetrahydro-3H-pyrrolizin-1-ylmethyl (2S)-2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate (PubChem CID 146159167) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-3H-pyrrolizin-1-ylmethyl (2S)-2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate.
| Compound Name | 5,6,7,8-tetrahydro-3H-pyrrolizin-1-ylmethyl (2S)-2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 146159167 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 5,6,7,8-tetrahydro-3H-pyrrolizin-1-ylmethyl (2S)-2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate |
| SMILES | CC(C)[C@@](O)(C(=O)OCC1=CCN2CCCC12)C(C)O |
| InChI | InChI=1S/C15H25NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h6,10-11,13,17,19H,4-5,7-9H2,1-3H3/t11?,13?,15-/m0/s1 |
| InChIKey | DRVWTOSBCBKXOR-HGMXIMQMSA-N |
| XLogP | 0.70 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|