C17H20N2 — CID 14615961
9-pyrrolidin-1-yl-1,2,3,4-tetrahydroacridine (PubChem CID 14615961) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 9-pyrrolidin-1-yl-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-pyrrolidin-1-yl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 14615961 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 9-pyrrolidin-1-yl-1,2,3,4-tetrahydroacridine |
| SMILES | c1ccc2c(N3CCCC3)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C17H20N2/c1-3-9-15-13(7-1)17(19-11-5-6-12-19)14-8-2-4-10-16(14)18-15/h1,3,7,9H,2,4-6,8,10-12H2 |
| InChIKey | MPPAGJFGXFSONE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |