About (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide
(6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide (PubChem CID 146160375) has the molecular formula C11H12FNO4S
and a molecular weight of 273.28 g/mol. Its IUPAC name is (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide.
Molecular Properties
| Compound Name | (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide |
| PubChem CID | 146160375 |
| Molecular Formula | C11H12FNO4S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide |
| SMILES | O=S(=O)(NCc1ccco1)C1=C(F)C=CC[C@H]1O |
| InChI | InChI=1S/C11H12FNO4S/c12-9-4-1-5-10(14)11(9)18(15,16)13-7-8-3-2-6-17-8/h1-4,6,10,13-14H,5,7H2/t10-/m1/s1 |
| InChIKey | LTTDZPWCAGOJCO-SNVBAGLBSA-N |
| XLogP | 1.20 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide?
The IUPAC name of (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide (CID 146160375) is (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide.
What is the SMILES notation for (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide?
The canonical SMILES for (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide is O=S(=O)(NCc1ccco1)C1=C(F)C=CC[C@H]1O.
What is the InChIKey of (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide?
The InChIKey is LTTDZPWCAGOJCO-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H12FNO4S/c12-9-4-1-5-10(14)11(9)18(15,16)13-7-8-3-2-6-17-8/h1-4,6,10,13-14H,5,7H2/t10-/m1/s1.
What are the key properties of (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide?
(6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide has a molecular weight of 273.28 g/mol, XLogP of 1.20, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2-fluoro-N-(furan-2-ylmethyl)-6-hydroxycyclohexa-1,3-diene-1-sulfonamide is sourced from PubChem (CID 146160375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).