About pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride
pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride (PubChem CID 146160527) has the molecular formula C7H9Cl2N3
and a molecular weight of 206.08 g/mol. Its IUPAC name is pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride |
| PubChem CID | 146160527 |
| Molecular Formula | C7H9Cl2N3 |
| Molecular Weight | 206.08 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cnc2cccn2c1 |
| InChI | InChI=1S/C7H7N3.2ClH/c8-6-4-9-7-2-1-3-10(7)5-6;;/h1-5H,8H2;2*1H |
| InChIKey | FXMFYXMFIIZFHI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.08 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride?
The IUPAC name of pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride (CID 146160527) is pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride.
What is the SMILES notation for pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride?
The canonical SMILES for pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride is Cl.Cl.Nc1cnc2cccn2c1.
What is the InChIKey of pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride?
The InChIKey is FXMFYXMFIIZFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.2ClH/c8-6-4-9-7-2-1-3-10(7)5-6;;/h1-5H,8H2;2*1H.
What are the key properties of pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride?
pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride has a molecular weight of 206.08 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[1,2-a]pyrimidin-3-amine;dihydrochloride is sourced from PubChem (CID 146160527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).