C21H27N — CID 146160786
1-(cyclohexylmethyl)-2-phenyl-4,5,6,7-tetrahydroindole (PubChem CID 146160786) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-2-phenyl-4,5,6,7-tetrahydroindole.
| Compound Name | 1-(cyclohexylmethyl)-2-phenyl-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 146160786 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-(cyclohexylmethyl)-2-phenyl-4,5,6,7-tetrahydroindole |
| SMILES | c1ccc(-c2cc3c(n2CC2CCCCC2)CCCC3)cc1 |
| InChI | InChI=1S/C21H27N/c1-3-9-17(10-4-1)16-22-20-14-8-7-13-19(20)15-21(22)18-11-5-2-6-12-18/h2,5-6,11-12,15,17H,1,3-4,7-10,13-14,16H2 |
| InChIKey | GZDHRPGMBZCNHU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |