C9H18Cl2N2O5PS2- — CID 146160946
2-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate (PubChem CID 146160946) has the molecular formula C9H18Cl2N2O5PS2- and a molecular weight of 400.27 g/mol. Its IUPAC name is 2-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate.
| Compound Name | 2-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate |
|---|---|
| PubChem CID | 146160946 |
| Molecular Formula | C9H18Cl2N2O5PS2- |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 2-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate |
| SMILES | O=P1(N(CCCl)CCCl)NC(SCCS(=O)(=O)[O-])CCO1 |
| InChI | InChI=1S/C9H19Cl2N2O5PS2/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17/h9H,1-8H2,(H,12,14)(H,15,16,17)/p-1 |
| InChIKey | PBUUPFTVAPUWDE-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|