C64H99N18O19 — CID 146161026
CID 146161026 (PubChem CID 146161026) has the molecular formula C64H99N18O19 and a molecular weight of 1424.60 g/mol.
| Compound Name | CID 146161026 |
|---|---|
| PubChem CID | 146161026 |
| Molecular Formula | C64H99N18O19 |
| Molecular Weight | 1424.60 g/mol |
| Exact Mass | 1423.73 |
| IUPAC Name | — |
| SMILES | CCC[CH]C(=O)NC(C)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC(N)=O)C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C64H99N18O19/c1-10-11-16-48(86)71-34(8)52(89)74-41(24-36-17-19-38(84)20-18-36)57(94)80-50(32(4)5)61(98)77-42(25-37-28-68-30-70-37)56(93)76-43(27-49(87)88)54(91)72-35(9)62(99)82-22-13-15-46(82)59(96)81-51(33(6)7)60(97)73-39(14-12-21-69-64(66)67)53(90)79-45(29-83)58(95)75-40(23-31(2)3)55(92)78-44(63(100)101)26-47(65)85/h16-20,28,30-35,39-46,50-51,83-84H,10-15,21-27,29H2,1-9H3,(H2,65,85)(H,68,70)(H,71,86)(H,72,91)(H,73,97)(H,74,89)(H,75,95)(H,76,93)(H,77,98)(H,78,92)(H,79,90)(H,80,94)(H,81,96)(H,87,88)(H,100,101)(H4,66,67,69) |
| InChIKey | CQSZCTQNACATQU-UHFFFAOYSA-N |
| XLogP | -4.89 |
| TPSA | 591.64 Ų |
| H-Bond Donors | 19 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 101 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1424.60 |
| LogP ≤ 5 | -4.89 |
| H-Bond Donors ≤ 5 | 19 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|