C36H58O4Si2 — CID 146161408
methyl (4S,5E,15E,17S,19Z)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]-19-methyldocosa-5,15,19-trien-7,10,13-triynoate (PubChem CID 146161408) has the molecular formula C36H58O4Si2 and a molecular weight of 611.03 g/mol. Its IUPAC name is methyl (4S,5E,15E,17S,19Z)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]-19-methyldocosa-5,15,19-trien-7,10,13-triynoate.
| Compound Name | methyl (4S,5E,15E,17S,19Z)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]-19-methyldocosa-5,15,19-trien-7,10,13-triynoate |
|---|---|
| PubChem CID | 146161408 |
| Molecular Formula | C36H58O4Si2 |
| Molecular Weight | 611.03 g/mol |
| Exact Mass | 610.39 |
| IUPAC Name | methyl (4S,5E,15E,17S,19Z)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]-19-methyldocosa-5,15,19-trien-7,10,13-triynoate |
| SMILES | CC/C=C(/C)C[C@@H](/C=C/C#CCC#CCC#C/C=C/[C@H](CCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H58O4Si2/c1-14-25-31(2)30-33(40-42(12,13)36(6,7)8)27-24-22-20-18-16-15-17-19-21-23-26-32(28-29-34(37)38-9)39-41(10,11)35(3,4)5/h23-27,32-33H,14,17-18,28-30H2,1-13H3/b26-23+,27-24+,31-25-/t32-,33-/m1/s1 |
| InChIKey | LXGTWNSEGXKCIE-GFXMDCGTSA-N |
| XLogP | 9.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.03 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|