C13H22OSi — CID 146161409
(3E,5S,7Z)-1-trimethylsilyldeca-3,7-dien-1-yn-5-ol (PubChem CID 146161409) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is (3E,5S,7Z)-1-trimethylsilyldeca-3,7-dien-1-yn-5-ol.
| Compound Name | (3E,5S,7Z)-1-trimethylsilyldeca-3,7-dien-1-yn-5-ol |
|---|---|
| PubChem CID | 146161409 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3E,5S,7Z)-1-trimethylsilyldeca-3,7-dien-1-yn-5-ol |
| SMILES | CC/C=C\C[C@H](O)/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi/c1-5-6-7-10-13(14)11-8-9-12-15(2,3)4/h6-8,11,13-14H,5,10H2,1-4H3/b7-6-,11-8+/t13-/m0/s1 |
| InChIKey | DMTBUTIXWBIPRF-YZPANATGSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|