C23H28O4 — CID 146161477
dimethyl (13R)-13-methyl-16-methylidene-1,3,6,7,11,12,15,17-octahydrocyclopenta[a]phenanthrene-2,2-dicarboxylate (PubChem CID 146161477) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is dimethyl (13R)-13-methyl-16-methylidene-1,3,6,7,11,12,15,17-octahydrocyclopenta[a]phenanthrene-2,2-dicarboxylate.
| Compound Name | dimethyl (13R)-13-methyl-16-methylidene-1,3,6,7,11,12,15,17-octahydrocyclopenta[a]phenanthrene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 146161477 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | dimethyl (13R)-13-methyl-16-methylidene-1,3,6,7,11,12,15,17-octahydrocyclopenta[a]phenanthrene-2,2-dicarboxylate |
| SMILES | C=C1CC2=C3CCC4=CCC(C(=O)OC)(C(=O)OC)CC4=C3CC[C@]2(C)C1 |
| InChI | InChI=1S/C23H28O4/c1-14-11-19-17-6-5-15-7-10-23(20(24)26-3,21(25)27-4)13-18(15)16(17)8-9-22(19,2)12-14/h7H,1,5-6,8-13H2,2-4H3/t22-/m1/s1 |
| InChIKey | KVLXKOLWQDFMHZ-JOCHJYFZSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|