About (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane
(1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane (PubChem CID 146161692) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane.
Molecular Properties
| Compound Name | (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane |
| PubChem CID | 146161692 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane |
| SMILES | C1C[C@@H]2CCN3CCC[C@]3(C1)C2 |
| InChI | InChI=1S/C11H19N/c1-3-10-4-8-12-7-2-6-11(12,5-1)9-10/h10H,1-9H2/t10-,11-/m1/s1 |
| InChIKey | DZKOIRYOUKOWQI-GHMZBOCLSA-N |
| XLogP | 2.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane?
The IUPAC name of (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane (CID 146161692) is (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane.
What is the SMILES notation for (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane?
The canonical SMILES for (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane is C1C[C@@H]2CCN3CCC[C@]3(C1)C2.
What is the InChIKey of (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane?
The InChIKey is DZKOIRYOUKOWQI-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H19N/c1-3-10-4-8-12-7-2-6-11(12,5-1)9-10/h10H,1-9H2/t10-,11-/m1/s1.
What are the key properties of (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane?
(1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane has a molecular weight of 165.28 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,8R)-5-azatricyclo[6.3.1.01,5]dodecane is sourced from PubChem (CID 146161692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).