About tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate
tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate (PubChem CID 146161713) has the molecular formula C20H25F2NO2
and a molecular weight of 349.42 g/mol. Its IUPAC name is tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate |
| PubChem CID | 146161713 |
| Molecular Formula | C20H25F2NO2 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC1(C2)C(c2ccccc2)C1(F)F |
| InChI | InChI=1S/C20H25F2NO2/c1-18(2,3)25-17(24)23-14-9-10-15(23)12-19(11-14)16(20(19,21)22)13-7-5-4-6-8-13/h4-8,14-16H,9-12H2,1-3H3 |
| InChIKey | QJBNIPCTMDHAEK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate?
The IUPAC name of tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate (CID 146161713) is tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate.
What is the SMILES notation for tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate?
The canonical SMILES for tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate is CC(C)(C)OC(=O)N1C2CCC1CC1(C2)C(c2ccccc2)C1(F)F.
What is the InChIKey of tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate?
The InChIKey is QJBNIPCTMDHAEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25F2NO2/c1-18(2,3)25-17(24)23-14-9-10-15(23)12-19(11-14)16(20(19,21)22)13-7-5-4-6-8-13/h4-8,14-16H,9-12H2,1-3H3.
What are the key properties of tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate?
tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate has a molecular weight of 349.42 g/mol, XLogP of 4.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1',1'-difluoro-3'-phenylspiro[8-azabicyclo[3.2.1]octane-3,2'-cyclopropane]-8-carboxylate is sourced from PubChem (CID 146161713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).