C27H19N3O7S — CID 146161921
methyl (1R,3aS,9bR)-1'-benzyl-8-nitro-2',4-dioxo-3-sulfanylidenespiro[2,9b-dihydrochromeno[3,4-c]pyrrole-1,3'-indole]-3a-carboxylate (PubChem CID 146161921) has the molecular formula C27H19N3O7S and a molecular weight of 529.53 g/mol. Its IUPAC name is methyl (1R,3aS,9bR)-1'-benzyl-8-nitro-2',4-dioxo-3-sulfanylidenespiro[2,9b-dihydrochromeno[3,4-c]pyrrole-1,3'-indole]-3a-carboxylate.
| Compound Name | methyl (1R,3aS,9bR)-1'-benzyl-8-nitro-2',4-dioxo-3-sulfanylidenespiro[2,9b-dihydrochromeno[3,4-c]pyrrole-1,3'-indole]-3a-carboxylate |
|---|---|
| PubChem CID | 146161921 |
| Molecular Formula | C27H19N3O7S |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | methyl (1R,3aS,9bR)-1'-benzyl-8-nitro-2',4-dioxo-3-sulfanylidenespiro[2,9b-dihydrochromeno[3,4-c]pyrrole-1,3'-indole]-3a-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)Oc3ccc([N+](=O)[O-])cc3[C@H]1[C@]1(NC2=S)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H19N3O7S/c1-36-24(32)26-21(17-13-16(30(34)35)11-12-20(17)37-25(26)33)27(28-22(26)38)18-9-5-6-10-19(18)29(23(27)31)14-15-7-3-2-4-8-15/h2-13,21H,14H2,1H3,(H,28,38)/t21-,26+,27+/m1/s1 |
| InChIKey | BAODRTGPYXQRJH-AIGMYPEUSA-N |
| XLogP | 3.13 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|